C27H22BrN3O6S — CID 126156610
2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 126156610) has the molecular formula C27H22BrN3O6S and a molecular weight of 596.46 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126156610 |
| Molecular Formula | C27H22BrN3O6S |
| Molecular Weight | 596.46 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1C(=O)S/C(=C\c2cc(Br)ccc2OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C27H22BrN3O6S/c1-16-4-3-5-17(2)25(16)29-24(32)14-30-26(33)23(38-27(30)34)13-19-12-20(28)8-11-22(19)37-15-18-6-9-21(10-7-18)31(35)36/h3-13H,14-15H2,1-2H3,(H,29,32)/b23-13- |
| InChIKey | BBCMLTPDFDEJIB-QRVIBDJDSA-N |
| XLogP | 6.23 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|