C24H19Cl3N4O4 — CID 126157140
N'-[(Z)-[4-[2-(5-chloro-2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide (PubChem CID 126157140) has the molecular formula C24H19Cl3N4O4 and a molecular weight of 533.80 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(5-chloro-2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(5-chloro-2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 126157140 |
| Molecular Formula | C24H19Cl3N4O4 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N'-[(Z)-[4-[2-(5-chloro-2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COc1ccc(/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C24H19Cl3N4O4/c1-14-5-8-16(25)11-20(14)29-21(32)13-35-17-9-6-15(7-10-17)12-28-31-24(34)23(33)30-19-4-2-3-18(26)22(19)27/h2-12H,13H2,1H3,(H,29,32)(H,30,33)(H,31,34)/b28-12- |
| InChIKey | FEQOETPJMBTGQI-NVJOKUIPSA-N |
| XLogP | 5.06 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|