C20H21BrN4O4 — CID 126157716
N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-ethyloxamide (PubChem CID 126157716) has the molecular formula C20H21BrN4O4 and a molecular weight of 461.32 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-ethyloxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-ethyloxamide |
|---|---|
| PubChem CID | 126157716 |
| Molecular Formula | C20H21BrN4O4 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C20H21BrN4O4/c1-3-22-19(27)20(28)25-23-11-14-4-7-16(8-5-14)29-12-18(26)24-15-6-9-17(21)13(2)10-15/h4-11H,3,12H2,1-2H3,(H,22,27)(H,24,26)(H,25,28)/b23-11- |
| InChIKey | GUJREBCSQNXSIY-KSEXSDGBSA-N |
| XLogP | 2.36 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|