C18H14ClN3O4 — CID 126163735
(3aR,4R,9bR)-6-chloro-8-nitro-4-(2-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126163735) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-chloro-8-nitro-4-(2-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-6-chloro-8-nitro-4-(2-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126163735 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (3aR,4R,9bR)-6-chloro-8-nitro-4-(2-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1cc(Cl)c2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccccc1[N+](=O)[O-])N2 |
| InChI | InChI=1S/C18H14ClN3O4/c19-15-9-10(21(23)24)8-14-11-5-3-6-12(11)17(20-18(14)15)13-4-1-2-7-16(13)22(25)26/h1-5,7-9,11-12,17,20H,6H2/t11-,12-,17-/m1/s1 |
| InChIKey | JFPQMRIDGYFWAH-PSTGCABASA-N |
| XLogP | 4.98 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|