C26H34N4O5 — CID 126164329
N-butyl-N'-[(Z)-[3-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126164329) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-butyl-N'-[(Z)-[3-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-butyl-N'-[(Z)-[3-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126164329 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-butyl-N'-[(Z)-[3-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCCCNC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2c(C)cc(C)cc2C)c(OCC)c1 |
| InChI | InChI=1S/C26H34N4O5/c1-6-8-11-27-25(32)26(33)30-28-15-20-9-10-21(22(14-20)34-7-2)35-16-23(31)29-24-18(4)12-17(3)13-19(24)5/h9-10,12-15H,6-8,11,16H2,1-5H3,(H,27,32)(H,29,31)(H,30,33)/b28-15- |
| InChIKey | JYTZMGHJPYFJRX-MBTHVWNTSA-N |
| XLogP | 3.39 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|