C25H19ClN2O4S — CID 126165729
N-(3-chlorophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126165729) has the molecular formula C25H19ClN2O4S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126165729 |
| Molecular Formula | C25H19ClN2O4S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccccc2OCc2ccccc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H19ClN2O4S/c26-19-10-6-11-20(14-19)27-23(29)15-28-24(30)22(33-25(28)31)13-18-9-4-5-12-21(18)32-16-17-7-2-1-3-8-17/h1-14H,15-16H2,(H,27,29)/b22-13+ |
| InChIKey | UEQXFLYFHGWXQT-LPYMAVHISA-N |
| XLogP | 5.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|