About 1-ethyl-1,2-diphenylhydrazine
1-ethyl-1,2-diphenylhydrazine (PubChem CID 12616656) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-ethyl-1,2-diphenylhydrazine.
Molecular Properties
| Compound Name | 1-ethyl-1,2-diphenylhydrazine |
| PubChem CID | 12616656 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-ethyl-1,2-diphenylhydrazine |
| SMILES | CCN(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16N2/c1-2-16(14-11-7-4-8-12-14)15-13-9-5-3-6-10-13/h3-12,15H,2H2,1H3 |
| InChIKey | KXJZSXTWZXLDJL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,2-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,2-diphenylhydrazine?
The IUPAC name of 1-ethyl-1,2-diphenylhydrazine (CID 12616656) is 1-ethyl-1,2-diphenylhydrazine.
What is the SMILES notation for 1-ethyl-1,2-diphenylhydrazine?
The canonical SMILES for 1-ethyl-1,2-diphenylhydrazine is CCN(Nc1ccccc1)c1ccccc1.
What is the InChIKey of 1-ethyl-1,2-diphenylhydrazine?
The InChIKey is KXJZSXTWZXLDJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-16(14-11-7-4-8-12-14)15-13-9-5-3-6-10-13/h3-12,15H,2H2,1H3.
What are the key properties of 1-ethyl-1,2-diphenylhydrazine?
1-ethyl-1,2-diphenylhydrazine has a molecular weight of 212.30 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,2-diphenylhydrazine is sourced from PubChem (CID 12616656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).