C19H13ClN2O5S — CID 126170163
4-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 126170163) has the molecular formula C19H13ClN2O5S and a molecular weight of 416.84 g/mol. Its IUPAC name is 4-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126170163 |
| Molecular Formula | C19H13ClN2O5S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(C(=O)O)cc2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN2O5S/c20-13-5-7-14(8-6-13)21-16(23)10-22-17(24)15(28-19(22)27)9-11-1-3-12(4-2-11)18(25)26/h1-9H,10H2,(H,21,23)(H,25,26)/b15-9- |
| InChIKey | ZBKXPHJHLIWCQI-DHDCSXOGSA-N |
| XLogP | 3.71 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|