C28H23ClN2O7S — CID 126172570
N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126172570) has the molecular formula C28H23ClN2O7S and a molecular weight of 567.02 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126172570 |
| Molecular Formula | C28H23ClN2O7S |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C28H23ClN2O7S/c1-2-35-23-11-17(7-9-21(23)36-15-18-5-3-4-6-20(18)29)12-25-27(33)31(28(34)39-25)14-26(32)30-19-8-10-22-24(13-19)38-16-37-22/h3-13H,2,14-16H2,1H3,(H,30,32)/b25-12+ |
| InChIKey | CSIKESGOPZRGLH-BRJLIKDPSA-N |
| XLogP | 5.72 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|