About S-phenyl decanethioate
S-phenyl decanethioate (PubChem CID 12617274) has the molecular formula C16H24OS
and a molecular weight of 264.43 g/mol. Its IUPAC name is S-phenyl decanethioate.
Molecular Properties
| Compound Name | S-phenyl decanethioate |
| PubChem CID | 12617274 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | S-phenyl decanethioate |
| SMILES | CCCCCCCCCC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H24OS/c1-2-3-4-5-6-7-11-14-16(17)18-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3 |
| InChIKey | WDIRIFOGOIERBO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl decanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl decanethioate?
The IUPAC name of S-phenyl decanethioate (CID 12617274) is S-phenyl decanethioate.
What is the SMILES notation for S-phenyl decanethioate?
The canonical SMILES for S-phenyl decanethioate is CCCCCCCCCC(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl decanethioate?
The InChIKey is WDIRIFOGOIERBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24OS/c1-2-3-4-5-6-7-11-14-16(17)18-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3.
What are the key properties of S-phenyl decanethioate?
S-phenyl decanethioate has a molecular weight of 264.43 g/mol, XLogP of 5.45, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl decanethioate is sourced from PubChem (CID 12617274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).