C19H15ClF3N — CID 126173112
(3aS,4R,9bR)-4-(3-chlorophenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126173112) has the molecular formula C19H15ClF3N and a molecular weight of 349.78 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3-chlorophenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3-chlorophenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126173112 |
| Molecular Formula | C19H15ClF3N |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (3aS,4R,9bR)-4-(3-chlorophenyl)-8-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C19H15ClF3N/c20-13-4-1-3-11(9-13)18-15-6-2-5-14(15)16-10-12(19(21,22)23)7-8-17(16)24-18/h1-5,7-10,14-15,18,24H,6H2/t14-,15+,18+/m1/s1 |
| InChIKey | GHNPBGOGXGMWNP-VKJFTORMSA-N |
| XLogP | 6.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|