C25H21F3N4O4 — CID 126173937
N'-[(Z)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 126173937) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 126173937 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N'-[(Z)-[4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(/C=N\NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H21F3N4O4/c1-16-5-2-3-8-21(16)31-22(33)15-36-20-11-9-17(10-12-20)14-29-32-24(35)23(34)30-19-7-4-6-18(13-19)25(26,27)28/h2-14H,15H2,1H3,(H,30,34)(H,31,33)(H,32,35)/b29-14- |
| InChIKey | JMFYCFIEGAAAHT-NUJZUDFISA-N |
| XLogP | 4.12 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|