About 1-(3-chlorophenyl)-N,N-dimethylmethanamine
1-(3-chlorophenyl)-N,N-dimethylmethanamine (PubChem CID 12617447) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-N,N-dimethylmethanamine |
| PubChem CID | 12617447 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-(3-chlorophenyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H12ClN/c1-11(2)7-8-4-3-5-9(10)6-8/h3-6H,7H2,1-2H3 |
| InChIKey | NMCHMNHSIHVTDC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-chlorophenyl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(3-chlorophenyl)-N,N-dimethylmethanamine (CID 12617447) is 1-(3-chlorophenyl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(3-chlorophenyl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(3-chlorophenyl)-N,N-dimethylmethanamine is CN(C)Cc1cccc(Cl)c1.
What is the InChIKey of 1-(3-chlorophenyl)-N,N-dimethylmethanamine?
The InChIKey is NMCHMNHSIHVTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN/c1-11(2)7-8-4-3-5-9(10)6-8/h3-6H,7H2,1-2H3.
What are the key properties of 1-(3-chlorophenyl)-N,N-dimethylmethanamine?
1-(3-chlorophenyl)-N,N-dimethylmethanamine has a molecular weight of 169.66 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-N,N-dimethylmethanamine is sourced from PubChem (CID 12617447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).