C29H31BrN4O5 — CID 126175114
N'-[(Z)-[3-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide (PubChem CID 126175114) has the molecular formula C29H31BrN4O5 and a molecular weight of 595.49 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126175114 |
| Molecular Formula | C29H31BrN4O5 |
| Molecular Weight | 595.49 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | N'-[(Z)-[3-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-butoxyphenyl)oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2cccc(OCC(=O)Nc3c(C)cc(Br)cc3C)c2)cc1 |
| InChI | InChI=1S/C29H31BrN4O5/c1-4-5-13-38-24-11-9-23(10-12-24)32-28(36)29(37)34-31-17-21-7-6-8-25(16-21)39-18-26(35)33-27-19(2)14-22(30)15-20(27)3/h6-12,14-17H,4-5,13,18H2,1-3H3,(H,32,36)(H,33,35)(H,34,37)/b31-17- |
| InChIKey | NWVQCRMPPYQSAB-LJUMEUDFSA-N |
| XLogP | 5.35 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|