C24H28N6O5S — CID 126176203
(2S)-N-[[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-(4-ethylphenoxy)propanamide (PubChem CID 126176203) has the molecular formula C24H28N6O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is (2S)-N-[[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-(4-ethylphenoxy)propanamide.
| Compound Name | (2S)-N-[[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-(4-ethylphenoxy)propanamide |
|---|---|
| PubChem CID | 126176203 |
| Molecular Formula | C24H28N6O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | (2S)-N-[[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-(4-ethylphenoxy)propanamide |
| SMILES | CCc1ccc(O[C@@H](C)C(=O)NCc2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)n2CC)cc1 |
| InChI | InChI=1S/C24H28N6O5S/c1-4-17-6-12-20(13-7-17)35-16(3)23(32)25-14-21-27-28-24(29(21)5-2)36-15-22(31)26-18-8-10-19(11-9-18)30(33)34/h6-13,16H,4-5,14-15H2,1-3H3,(H,25,32)(H,26,31)/t16-/m0/s1 |
| InChIKey | SYJFPUXLKYMEMC-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|