C20H20IN5O2S — CID 126177179
N-[[5-[2-(4-iodoanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]-2-phenylacetamide (PubChem CID 126177179) has the molecular formula C20H20IN5O2S and a molecular weight of 521.38 g/mol. Its IUPAC name is N-[[5-[2-(4-iodoanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]-2-phenylacetamide.
| Compound Name | N-[[5-[2-(4-iodoanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 126177179 |
| Molecular Formula | C20H20IN5O2S |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | N-[[5-[2-(4-iodoanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]-2-phenylacetamide |
| SMILES | Cn1c(CNC(=O)Cc2ccccc2)nnc1SCC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H20IN5O2S/c1-26-17(12-22-18(27)11-14-5-3-2-4-6-14)24-25-20(26)29-13-19(28)23-16-9-7-15(21)8-10-16/h2-10H,11-13H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | XBDGJPCFGZYLIL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|