C20H15N5O5S2 — CID 126178383
N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-[5-(phenoxymethyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide (PubChem CID 126178383) has the molecular formula C20H15N5O5S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-[5-(phenoxymethyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide.
| Compound Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-[5-(phenoxymethyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 126178383 |
| Molecular Formula | C20H15N5O5S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-[5-(phenoxymethyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
| SMILES | O=C(Cn1nc(COc2ccccc2)oc1=S)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C20H15N5O5S2/c26-17(10-24-20(31)30-18(23-24)11-29-15-7-2-1-3-8-15)22-19-21-16(12-32-19)13-5-4-6-14(9-13)25(27)28/h1-9,12H,10-11H2,(H,21,22,26) |
| InChIKey | HLWHZKZKDMJQMB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|