C26H22Cl2N4O5 — CID 126178446
N'-[(Z)-[3-[2-(2,3-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126178446) has the molecular formula C26H22Cl2N4O5 and a molecular weight of 541.39 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(2,3-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(2,3-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126178446 |
| Molecular Formula | C26H22Cl2N4O5 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | N'-[(Z)-[3-[2-(2,3-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2cccc(OCC(=O)Nc3cccc(Cl)c3Cl)c2)cc1 |
| InChI | InChI=1S/C26H22Cl2N4O5/c1-2-13-36-19-11-9-18(10-12-19)30-25(34)26(35)32-29-15-17-5-3-6-20(14-17)37-16-23(33)31-22-8-4-7-21(27)24(22)28/h2-12,14-15H,1,13,16H2,(H,30,34)(H,31,33)(H,32,35)/b29-15- |
| InChIKey | IYIBXIZVULQBTP-FDVSRXAVSA-N |
| XLogP | 4.66 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|