C23H26N6O3S2 — CID 126178839
2-[[2-[4-methyl-3-[[(2-methylbenzoyl)amino]methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126178839) has the molecular formula C23H26N6O3S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[[2-[4-methyl-3-[[(2-methylbenzoyl)amino]methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-methyl-3-[[(2-methylbenzoyl)amino]methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126178839 |
| Molecular Formula | C23H26N6O3S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[[2-[4-methyl-3-[[(2-methylbenzoyl)amino]methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccccc1C(=O)NCc1nn(CC(=O)Nc2sc3c(c2C(N)=O)CCCC3)c(=S)n1C |
| InChI | InChI=1S/C23H26N6O3S2/c1-13-7-3-4-8-14(13)21(32)25-11-17-27-29(23(33)28(17)2)12-18(30)26-22-19(20(24)31)15-9-5-6-10-16(15)34-22/h3-4,7-8H,5-6,9-12H2,1-2H3,(H2,24,31)(H,25,32)(H,26,30) |
| InChIKey | KUFQBBLXIUWYLI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|