About 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one
2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 12617988) has the molecular formula C17H11ClN2O2
and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| PubChem CID | 12617988 |
| Molecular Formula | C17H11ClN2O2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1Cc1ccccc1O2 |
| InChI | InChI=1S/C17H11ClN2O2/c18-12-7-5-10(6-8-12)15-19-16(21)13-9-11-3-1-2-4-14(11)22-17(13)20-15/h1-8H,9H2,(H,19,20,21) |
| InChIKey | ZCOBKVFRJXIRKT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (CID 12617988) is 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1Cc1ccccc1O2.
What is the InChIKey of 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The InChIKey is ZCOBKVFRJXIRKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN2O2/c18-12-7-5-10(6-8-12)15-19-16(21)13-9-11-3-1-2-4-14(11)22-17(13)20-15/h1-8H,9H2,(H,19,20,21).
What are the key properties of 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one has a molecular weight of 310.74 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 12617988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).