C28H27F3N4O6 — CID 126180831
N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 126180831) has the molecular formula C28H27F3N4O6 and a molecular weight of 572.54 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126180831 |
| Molecular Formula | C28H27F3N4O6 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc(OC)cc2)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F3N4O6/c1-3-40-24-13-19(16-33-35-27(38)26(37)32-15-18-7-10-22(39-2)11-8-18)9-12-23(24)41-17-25(36)34-21-6-4-5-20(14-21)28(29,30)31/h4-14,16H,3,15,17H2,1-2H3,(H,32,37)(H,34,36)(H,35,38)/b33-16- |
| InChIKey | NNIJDADBDNEJBB-BJUCDSOZSA-N |
| XLogP | 3.90 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|