C18H17IN4O — CID 126182020
2-(4-iodoanilino)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]acetamide (PubChem CID 126182020) has the molecular formula C18H17IN4O and a molecular weight of 432.27 g/mol. Its IUPAC name is 2-(4-iodoanilino)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-iodoanilino)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126182020 |
| Molecular Formula | C18H17IN4O |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2-(4-iodoanilino)-N-[(Z)-(1-methylindol-3-yl)methylideneamino]acetamide |
| SMILES | Cn1cc(/C=N\NC(=O)CNc2ccc(I)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H17IN4O/c1-23-12-13(16-4-2-3-5-17(16)23)10-21-22-18(24)11-20-15-8-6-14(19)7-9-15/h2-10,12,20H,11H2,1H3,(H,22,24)/b21-10- |
| InChIKey | BNUFDDPUWHZHRF-FBHDLOMBSA-N |
| XLogP | 3.35 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|