C22H26N4O5 — CID 126182539
N'-[(Z)-[3-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)oxamide (PubChem CID 126182539) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 126182539 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N'-[(Z)-[3-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)N/N=C\c1cccc(OCC(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C22H26N4O5/c1-15-7-8-19(16(2)11-15)25-20(27)14-31-18-6-4-5-17(12-18)13-24-26-22(29)21(28)23-9-10-30-3/h4-8,11-13H,9-10,14H2,1-3H3,(H,23,28)(H,25,27)(H,26,29)/b24-13- |
| InChIKey | ZLDFOHLCOMCPJC-CFRMEGHHSA-N |
| XLogP | 1.53 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|