C29H26IN3O4S — CID 126182722
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 126182722) has the molecular formula C29H26IN3O4S and a molecular weight of 639.52 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 126182722 |
| Molecular Formula | C29H26IN3O4S |
| Molecular Weight | 639.52 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26IN3O4S/c1-21(22-10-4-2-5-11-22)31-29(35)26-14-8-9-15-27(26)32-28(34)20-33(24-18-16-23(30)17-19-24)38(36,37)25-12-6-3-7-13-25/h2-19,21H,20H2,1H3,(H,31,35)(H,32,34)/t21-/m1/s1 |
| InChIKey | NNRFAOAMENSPAA-OAQYLSRUSA-N |
| XLogP | 5.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|