About (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol
(4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol (PubChem CID 12618573) has the molecular formula C13H18OSe
and a molecular weight of 269.25 g/mol. Its IUPAC name is (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol.
Molecular Properties
| Compound Name | (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol |
| PubChem CID | 12618573 |
| Molecular Formula | C13H18OSe |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol |
| SMILES | CC1(C)C[C@@H](O)C[C@H](c2ccccc2)[Se]1 |
| InChI | InChI=1S/C13H18OSe/c1-13(2)9-11(14)8-12(15-13)10-6-4-3-5-7-10/h3-7,11-12,14H,8-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | PTVVPVIJZLQXCB-NWDGAFQWSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol?
The IUPAC name of (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol (CID 12618573) is (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol.
What is the SMILES notation for (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol?
The canonical SMILES for (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol is CC1(C)C[C@@H](O)C[C@H](c2ccccc2)[Se]1.
What is the InChIKey of (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol?
The InChIKey is PTVVPVIJZLQXCB-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H18OSe/c1-13(2)9-11(14)8-12(15-13)10-6-4-3-5-7-10/h3-7,11-12,14H,8-9H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol?
(4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol has a molecular weight of 269.25 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6R)-2,2-dimethyl-6-phenylselenan-4-ol is sourced from PubChem (CID 12618573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).