C14H15ClFNO — CID 126185774
(2Z,6S)-2-[(3-chloro-4-fluoroanilino)methylidene]-6-methylcyclohexan-1-one (PubChem CID 126185774) has the molecular formula C14H15ClFNO and a molecular weight of 267.73 g/mol. Its IUPAC name is (2Z,6S)-2-[(3-chloro-4-fluoroanilino)methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2Z,6S)-2-[(3-chloro-4-fluoroanilino)methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 126185774 |
| Molecular Formula | C14H15ClFNO |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2Z,6S)-2-[(3-chloro-4-fluoroanilino)methylidene]-6-methylcyclohexan-1-one |
| SMILES | C[C@H]1CCC/C(=C/Nc2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C14H15ClFNO/c1-9-3-2-4-10(14(9)18)8-17-11-5-6-13(16)12(15)7-11/h5-9,17H,2-4H2,1H3/b10-8-/t9-/m0/s1 |
| InChIKey | RTXDYAZPMKYPDG-CUQRQBARSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|