About carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese
carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese (PubChem CID 12618807) has the molecular formula C10H7MnO4-
and a molecular weight of 246.10 g/mol. Its IUPAC name is carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese.
Molecular Properties
| Compound Name | carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese |
| PubChem CID | 12618807 |
| Molecular Formula | C10H7MnO4- |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese |
| SMILES | CC([O-])=C1C=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mn] |
| InChI | InChI=1S/C7H8O.3CO.Mn/c1-6(8)7-4-2-3-5-7;3*1-2;/h2-5,8H,1H3;;;;/p-1 |
| InChIKey | XVVOHXHJKMXSAU-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese?
The IUPAC name of carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese (CID 12618807) is carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese.
What is the SMILES notation for carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese?
The canonical SMILES for carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese is CC([O-])=C1C=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mn].
What is the InChIKey of carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese?
The InChIKey is XVVOHXHJKMXSAU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.3CO.Mn/c1-6(8)7-4-2-3-5-7;3*1-2;/h2-5,8H,1H3;;;;/p-1.
What are the key properties of carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese?
carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese has a molecular weight of 246.10 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;1-cyclopenta-2,4-dien-1-ylideneethanolate;manganese is sourced from PubChem (CID 12618807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).