C38H32N4O6S — CID 126190067
N-benzhydryl-2-[(5E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126190067) has the molecular formula C38H32N4O6S and a molecular weight of 672.76 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126190067 |
| Molecular Formula | C38H32N4O6S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | N-benzhydryl-2-[(5E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccc(-c3ccc(C)c([N+](=O)[O-])c3)o2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H32N4O6S/c1-4-6-17-29(5-2)41-37(45)31(23-30-20-21-33(48-30)28-19-18-25(3)32(22-28)42(46)47)36(44)40-38(41)49-24-34(43)39-35(26-13-9-7-10-14-26)27-15-11-8-12-16-27/h4-23,35H,1,24H2,2-3H3,(H,39,43)/b17-6-,29-5+,31-23+ |
| InChIKey | DOYAFQGQAMWPEN-OCWCBZJMSA-N |
| XLogP | 7.56 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|