5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid

C5H4N2O4 — CID 12619140

IUPAC5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid
SMILESO=C(O)c1c[nH]c(=O)c(=O)[nH]1
InChIInChI=1S/C5H4N2O4/c8-3-4(9)7-2(1-6-3)5(10)11/h1H,(H,6,8)(H,7,9)(H,10,11)
InChIKeyGKJAAQNJIUKDQK-UHFFFAOYSA-N
MW156.10 g/mol
LogP-1.24
Rot. Bonds1

About 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid

5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid (PubChem CID 12619140) has the molecular formula C5H4N2O4 and a molecular weight of 156.10 g/mol. Its IUPAC name is 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid.

Molecular Properties

Compound Name5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid
PubChem CID12619140
Molecular FormulaC5H4N2O4
Molecular Weight156.10 g/mol
Exact Mass156.02
IUPAC Name5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid
SMILESO=C(O)c1c[nH]c(=O)c(=O)[nH]1
InChIInChI=1S/C5H4N2O4/c8-3-4(9)7-2(1-6-3)5(10)11/h1H,(H,6,8)(H,7,9)(H,10,11)
InChIKeyGKJAAQNJIUKDQK-UHFFFAOYSA-N
XLogP-1.24
TPSA103.02 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.10
LogP ≤ 5-1.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The IUPAC name of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid (CID 12619140) is 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid.
What is the SMILES notation for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The canonical SMILES for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid is O=C(O)c1c[nH]c(=O)c(=O)[nH]1.
What is the InChIKey of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The InChIKey is GKJAAQNJIUKDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4/c8-3-4(9)7-2(1-6-3)5(10)11/h1H,(H,6,8)(H,7,9)(H,10,11).
What are the key properties of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid has a molecular weight of 156.10 g/mol, XLogP of -1.24, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid is sourced from PubChem (CID 12619140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).