About 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid
5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid (PubChem CID 12619140) has the molecular formula C5H4N2O4
and a molecular weight of 156.10 g/mol. Its IUPAC name is 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid |
| PubChem CID | 12619140 |
| Molecular Formula | C5H4N2O4 |
| Molecular Weight | 156.10 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C5H4N2O4/c8-3-4(9)7-2(1-6-3)5(10)11/h1H,(H,6,8)(H,7,9)(H,10,11) |
| InChIKey | GKJAAQNJIUKDQK-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.10 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The IUPAC name of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid (CID 12619140) is 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid.
What is the SMILES notation for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The canonical SMILES for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid is O=C(O)c1c[nH]c(=O)c(=O)[nH]1.
What is the InChIKey of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
The InChIKey is GKJAAQNJIUKDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4/c8-3-4(9)7-2(1-6-3)5(10)11/h1H,(H,6,8)(H,7,9)(H,10,11).
What are the key properties of 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid?
5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid has a molecular weight of 156.10 g/mol, XLogP of -1.24, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dioxo-1,4-dihydropyrazine-2-carboxylic acid is sourced from PubChem (CID 12619140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).