C38H36BrN3O5S — CID 126191689
N-benzhydryl-2-[(5E)-5-[(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126191689) has the molecular formula C38H36BrN3O5S and a molecular weight of 726.69 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126191689 |
| Molecular Formula | C38H36BrN3O5S |
| Molecular Weight | 726.69 g/mol |
| Exact Mass | 725.16 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(OCC)c(OCC=C)cc2Br)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H36BrN3O5S/c1-5-9-20-29(7-3)42-37(45)30(22-28-23-32(46-8-4)33(24-31(28)39)47-21-6-2)36(44)41-38(42)48-25-34(43)40-35(26-16-12-10-13-17-26)27-18-14-11-15-19-27/h5-7,9-20,22-24,35H,1-2,8,21,25H2,3-4H3,(H,40,43)/b20-9-,29-7+,30-22+ |
| InChIKey | LLYNJXYUBPRZTF-GTMOSFRESA-N |
| XLogP | 7.81 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|