About 1-(1-adamantyl)-2,2-dimethylpropan-1-amine
1-(1-adamantyl)-2,2-dimethylpropan-1-amine (PubChem CID 12619343) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-(1-adamantyl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 12619343 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-(1-adamantyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H27N/c1-14(2,3)13(16)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-13H,4-9,16H2,1-3H3 |
| InChIKey | DKRPVOXRQOGIOQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(1-adamantyl)-2,2-dimethylpropan-1-amine (CID 12619343) is 1-(1-adamantyl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(1-adamantyl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(1-adamantyl)-2,2-dimethylpropan-1-amine is CC(C)(C)C(N)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-2,2-dimethylpropan-1-amine?
The InChIKey is DKRPVOXRQOGIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-14(2,3)13(16)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-13H,4-9,16H2,1-3H3.
What are the key properties of 1-(1-adamantyl)-2,2-dimethylpropan-1-amine?
1-(1-adamantyl)-2,2-dimethylpropan-1-amine has a molecular weight of 221.39 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 12619343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).