C28H29ClN4O2 — CID 126193611
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 126193611) has the molecular formula C28H29ClN4O2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126193611 |
| Molecular Formula | C28H29ClN4O2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | CCOc1ccc(-n2c(C)cc(C=NNC(=O)c3cc(-n4c(C)ccc4C)ccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C28H29ClN4O2/c1-6-35-25-12-9-23(10-13-25)33-20(4)15-22(21(33)5)17-30-31-28(34)26-16-24(11-14-27(26)29)32-18(2)7-8-19(32)3/h7-17H,6H2,1-5H3,(H,31,34) |
| InChIKey | PLLYRXSHGQTMRL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|