About 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide
1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 1261937) has the molecular formula C17H23Cl2N3O3S
and a molecular weight of 420.36 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide |
| PubChem CID | 1261937 |
| Molecular Formula | C17H23Cl2N3O3S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O3S/c18-13-4-5-14(19)15(12-13)26(24,25)22-10-6-17(7-11-22,16(20)23)21-8-2-1-3-9-21/h4-5,12H,1-3,6-11H2,(H2,20,23) |
| InChIKey | SDZBEWQAIVVKOV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide?
The IUPAC name of 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide (CID 1261937) is 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide.
What is the SMILES notation for 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide?
The canonical SMILES for 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide is NC(=O)C1(N2CCCCC2)CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1.
What is the InChIKey of 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide?
The InChIKey is SDZBEWQAIVVKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23Cl2N3O3S/c18-13-4-5-14(19)15(12-13)26(24,25)22-10-6-17(7-11-22,16(20)23)21-8-2-1-3-9-21/h4-5,12H,1-3,6-11H2,(H2,20,23).
What are the key properties of 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide?
1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide has a molecular weight of 420.36 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichlorophenyl)sulfonyl-4-piperidin-1-ylpiperidine-4-carboxamide is sourced from PubChem (CID 1261937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).