About 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine
1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine (PubChem CID 126195588) has the molecular formula C27H21Br2NO3
and a molecular weight of 567.28 g/mol. Its IUPAC name is 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine.
Molecular Properties
| Compound Name | 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine |
| PubChem CID | 126195588 |
| Molecular Formula | C27H21Br2NO3 |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine |
| SMILES | COc1ccc(Oc2ccc(/N=C/c3ccc(OCc4ccc(Br)cc4Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H21Br2NO3/c1-31-23-12-14-26(15-13-23)33-25-10-6-22(7-11-25)30-17-19-2-8-24(9-3-19)32-18-20-4-5-21(28)16-27(20)29/h2-17H,18H2,1H3/b30-17+ |
| InChIKey | JSANRZVDKKIHOQ-OCSSWDANSA-N |
| XLogP | 8.34 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine?
The IUPAC name of 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine (CID 126195588) is 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine.
What is the SMILES notation for 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine?
The canonical SMILES for 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine is COc1ccc(Oc2ccc(/N=C/c3ccc(OCc4ccc(Br)cc4Br)cc3)cc2)cc1.
What is the InChIKey of 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine?
The InChIKey is JSANRZVDKKIHOQ-OCSSWDANSA-N. The full InChI is InChI=1S/C27H21Br2NO3/c1-31-23-12-14-26(15-13-23)33-25-10-6-22(7-11-25)30-17-19-2-8-24(9-3-19)32-18-20-4-5-21(28)16-27(20)29/h2-17H,18H2,1H3/b30-17+.
What are the key properties of 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine?
1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine has a molecular weight of 567.28 g/mol, XLogP of 8.34, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine is sourced from PubChem (CID 126195588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).