C24H26N2O4 — CID 126200752
(5Z)-1-cyclopentyl-5-[[4-(2-methylpropoxy)naphthalen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126200752) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (5Z)-1-cyclopentyl-5-[[4-(2-methylpropoxy)naphthalen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-cyclopentyl-5-[[4-(2-methylpropoxy)naphthalen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126200752 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (5Z)-1-cyclopentyl-5-[[4-(2-methylpropoxy)naphthalen-1-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)COc1ccc(/C=C2/C(=O)NC(=O)N(C3CCCC3)C2=O)c2ccccc12 |
| InChI | InChI=1S/C24H26N2O4/c1-15(2)14-30-21-12-11-16(18-9-5-6-10-19(18)21)13-20-22(27)25-24(29)26(23(20)28)17-7-3-4-8-17/h5-6,9-13,15,17H,3-4,7-8,14H2,1-2H3,(H,25,27,29)/b20-13- |
| InChIKey | MUZRCCCWHNMJRQ-MOSHPQCFSA-N |
| XLogP | 4.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|