C26H22N4O3 — CID 126200971
4-[[3-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126200971) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-[[3-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126200971 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-[[3-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2cc(/C=C3/C(=O)NC(=O)N(C4CCCC4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H22N4O3/c27-14-17-9-11-18(12-10-17)15-29-16-19(21-7-3-4-8-23(21)29)13-22-24(31)28-26(33)30(25(22)32)20-5-1-2-6-20/h3-4,7-13,16,20H,1-2,5-6,15H2,(H,28,31,33)/b22-13- |
| InChIKey | LUMTXLRWSMWILP-XKZIYDEJSA-N |
| XLogP | 3.97 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|