About [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate
[4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate (PubChem CID 1262012) has the molecular formula C23H18ClNO5
and a molecular weight of 423.85 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate |
| PubChem CID | 1262012 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCc2ccc(C(=O)Oc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C23H18ClNO5/c1-15(26)25-20-4-2-3-18(13-20)22(27)29-14-16-5-7-17(8-6-16)23(28)30-21-11-9-19(24)10-12-21/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | PFQIDZPZYCNFEF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate?
The IUPAC name of [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate (CID 1262012) is [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate.
What is the SMILES notation for [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate?
The canonical SMILES for [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate is CC(=O)Nc1cccc(C(=O)OCc2ccc(C(=O)Oc3ccc(Cl)cc3)cc2)c1.
What is the InChIKey of [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate?
The InChIKey is PFQIDZPZYCNFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClNO5/c1-15(26)25-20-4-2-3-18(13-20)22(27)29-14-16-5-7-17(8-6-16)23(28)30-21-11-9-19(24)10-12-21/h2-13H,14H2,1H3,(H,25,26).
What are the key properties of [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate?
[4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate has a molecular weight of 423.85 g/mol, XLogP of 4.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenoxy)carbonylphenyl]methyl 3-acetamidobenzoate is sourced from PubChem (CID 1262012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).