C23H22BrClN2O4S — CID 126204078
2-[(4-bromophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]-N-(2-ethoxyphenyl)acetamide (PubChem CID 126204078) has the molecular formula C23H22BrClN2O4S and a molecular weight of 537.86 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126204078 |
| Molecular Formula | C23H22BrClN2O4S |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(Cc1ccccc1Cl)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrClN2O4S/c1-2-31-22-10-6-5-9-21(22)26-23(28)16-27(15-17-7-3-4-8-20(17)25)32(29,30)19-13-11-18(24)12-14-19/h3-14H,2,15-16H2,1H3,(H,26,28) |
| InChIKey | QEXFKZIFKMDHRC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |