About 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid
5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid (PubChem CID 12620584) has the molecular formula C13H9NO4
and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid |
| PubChem CID | 12620584 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid |
| SMILES | Cn1c2ccccc2c2oc(C(=O)O)cc(=O)c21 |
| InChI | InChI=1S/C13H9NO4/c1-14-8-5-3-2-4-7(8)12-11(14)9(15)6-10(18-12)13(16)17/h2-6H,1H3,(H,16,17) |
| InChIKey | RNLKZNUNWYKYRF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid (CID 12620584) is 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid is Cn1c2ccccc2c2oc(C(=O)O)cc(=O)c21.
What is the InChIKey of 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
The InChIKey is RNLKZNUNWYKYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO4/c1-14-8-5-3-2-4-7(8)12-11(14)9(15)6-10(18-12)13(16)17/h2-6H,1H3,(H,16,17).
What are the key properties of 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid?
5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid has a molecular weight of 243.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-oxopyrano[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 12620584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).