About N,N-dimethyl-1-phenylmethanamine;gold(1+)
N,N-dimethyl-1-phenylmethanamine;gold(1+) (PubChem CID 12620686) has the molecular formula C9H12AuN
and a molecular weight of 331.17 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;gold(1+).
Molecular Properties
| Compound Name | N,N-dimethyl-1-phenylmethanamine;gold(1+) |
| PubChem CID | 12620686 |
| Molecular Formula | C9H12AuN |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;gold(1+) |
| SMILES | CN(C)Cc1[c-]cccc1.[Au+] |
| InChI | InChI=1S/C9H12N.Au/c1-10(2)8-9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1;+1 |
| InChIKey | LXMSSLXOPJHYMM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-phenylmethanamine;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-phenylmethanamine;gold(1+)?
The IUPAC name of N,N-dimethyl-1-phenylmethanamine;gold(1+) (CID 12620686) is N,N-dimethyl-1-phenylmethanamine;gold(1+).
What is the SMILES notation for N,N-dimethyl-1-phenylmethanamine;gold(1+)?
The canonical SMILES for N,N-dimethyl-1-phenylmethanamine;gold(1+) is CN(C)Cc1[c-]cccc1.[Au+].
What is the InChIKey of N,N-dimethyl-1-phenylmethanamine;gold(1+)?
The InChIKey is LXMSSLXOPJHYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Au/c1-10(2)8-9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1;+1.
What are the key properties of N,N-dimethyl-1-phenylmethanamine;gold(1+)?
N,N-dimethyl-1-phenylmethanamine;gold(1+) has a molecular weight of 331.17 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-phenylmethanamine;gold(1+) is sourced from PubChem (CID 12620686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).