C17H11F3N2O3 — CID 126207531
N-[(E)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126207531) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is N-[(E)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126207531 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-[(E)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2ccccc2C(F)(F)F)o1)c1ccco1 |
| InChI | InChI=1S/C17H11F3N2O3/c18-17(19,20)13-5-2-1-4-12(13)14-8-7-11(25-14)10-21-22-16(23)15-6-3-9-24-15/h1-10H,(H,22,23)/b21-10+ |
| InChIKey | LKPHPMLCMSDELN-UFFVCSGVSA-N |
| XLogP | 4.32 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|