C18H17BrN2O5 — CID 126207694
2-[2-[(E)-[(3-bromobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126207694) has the molecular formula C18H17BrN2O5 and a molecular weight of 421.25 g/mol. Its IUPAC name is 2-[2-[(E)-[(3-bromobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[(3-bromobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126207694 |
| Molecular Formula | C18H17BrN2O5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 2-[2-[(E)-[(3-bromobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cccc(/C=N/NC(=O)c2cccc(Br)c2)c1OCC(=O)O |
| InChI | InChI=1S/C18H17BrN2O5/c1-2-25-15-8-4-6-13(17(15)26-11-16(22)23)10-20-21-18(24)12-5-3-7-14(19)9-12/h3-10H,2,11H2,1H3,(H,21,24)(H,22,23)/b20-10+ |
| InChIKey | NJPOQXTXWFPSRL-KEBDBYFISA-N |
| XLogP | 3.08 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|