C4H8N6O — CID 12621025
3,5-diamino-1H-pyrazole-4-carbohydrazide (PubChem CID 12621025) has the molecular formula C4H8N6O and a molecular weight of 156.15 g/mol. Its IUPAC name is 3,5-diamino-1H-pyrazole-4-carbohydrazide.
| Compound Name | 3,5-diamino-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 12621025 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3,5-diamino-1H-pyrazole-4-carbohydrazide |
| SMILES | NNC(=O)c1c(N)n[nH]c1N |
| InChI | InChI=1S/C4H8N6O/c5-2-1(4(11)8-7)3(6)10-9-2/h7H2,(H,8,11)(H5,5,6,9,10) |
| InChIKey | IQRPKCYRXQJIAB-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|