C20H17BrClNO3S2 — CID 126210292
(5E)-3-(3-bromophenyl)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126210292) has the molecular formula C20H17BrClNO3S2 and a molecular weight of 498.85 g/mol. Its IUPAC name is (5E)-3-(3-bromophenyl)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-bromophenyl)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126210292 |
| Molecular Formula | C20H17BrClNO3S2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | (5E)-3-(3-bromophenyl)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3cccc(Br)c3)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C20H17BrClNO3S2/c1-3-25-16-9-12(8-15(22)18(16)26-4-2)10-17-19(24)23(20(27)28-17)14-7-5-6-13(21)11-14/h5-11H,3-4H2,1-2H3/b17-10+ |
| InChIKey | AKUTVQVDIPRVCZ-LICLKQGHSA-N |
| XLogP | 6.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|