About 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide
2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide (PubChem CID 1262106) has the molecular formula C21H20N4O4
and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide |
| PubChem CID | 1262106 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide |
| SMILES | O=C(/N=N/C(=O)c1ccc2c(O)n(C3CCCCC3)c(O)c2c1)c1cccnc1 |
| InChI | InChI=1S/C21H20N4O4/c26-18(23-24-19(27)14-5-4-10-22-12-14)13-8-9-16-17(11-13)21(29)25(20(16)28)15-6-2-1-3-7-15/h4-5,8-12,15,28-29H,1-3,6-7H2/b24-23+ |
| InChIKey | ZXEXBJPXQZCIEU-WCWDXBQESA-N |
| XLogP | 4.39 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide?
The IUPAC name of 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide (CID 1262106) is 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide.
What is the SMILES notation for 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide?
The canonical SMILES for 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide is O=C(/N=N/C(=O)c1ccc2c(O)n(C3CCCCC3)c(O)c2c1)c1cccnc1.
What is the InChIKey of 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide?
The InChIKey is ZXEXBJPXQZCIEU-WCWDXBQESA-N. The full InChI is InChI=1S/C21H20N4O4/c26-18(23-24-19(27)14-5-4-10-22-12-14)13-8-9-16-17(11-13)21(29)25(20(16)28)15-6-2-1-3-7-15/h4-5,8-12,15,28-29H,1-3,6-7H2/b24-23+.
What are the key properties of 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide?
2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide has a molecular weight of 392.42 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,3-dihydroxy-N-(pyridine-3-carbonylimino)isoindole-5-carboxamide is sourced from PubChem (CID 1262106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).