C24H19ClFN3O5S — CID 126210952
butyl 2-[(5E)-5-[[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126210952) has the molecular formula C24H19ClFN3O5S and a molecular weight of 515.95 g/mol. Its IUPAC name is butyl 2-[(5E)-5-[[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5E)-5-[[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126210952 |
| Molecular Formula | C24H19ClFN3O5S |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | butyl 2-[(5E)-5-[[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C/c2c(Oc3nc(Cl)ncc3F)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C24H19ClFN3O5S/c1-2-3-10-33-20(30)13-29-22(31)19(35-24(29)32)11-16-15-7-5-4-6-14(15)8-9-18(16)34-21-17(26)12-27-23(25)28-21/h4-9,11-12H,2-3,10,13H2,1H3/b19-11+ |
| InChIKey | JTHNBWOPVMIKBC-YBFXNURJSA-N |
| XLogP | 5.59 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|