C22H17ClN4O3 — CID 126211328
1-(4-chlorophenyl)-5-cyano-4-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-6-oxopyridazine-3-carboxylic acid (PubChem CID 126211328) has the molecular formula C22H17ClN4O3 and a molecular weight of 420.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-cyano-4-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-5-cyano-4-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126211328 |
| Molecular Formula | C22H17ClN4O3 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-cyano-4-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-6-oxopyridazine-3-carboxylic acid |
| SMILES | CN(C)c1ccc(/C=C\c2c(C(=O)O)nn(-c3ccc(Cl)cc3)c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C22H17ClN4O3/c1-26(2)16-8-3-14(4-9-16)5-12-18-19(13-24)21(28)27(25-20(18)22(29)30)17-10-6-15(23)7-11-17/h3-12H,1-2H3,(H,29,30)/b12-5- |
| InChIKey | LYCPNJSIBDGYCB-XGICHPGQSA-N |
| XLogP | 3.69 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|