C20H16Cl2N2O3 — CID 126211449
3,4-dichloro-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126211449) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | 3,4-dichloro-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126211449 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3,4-dichloro-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(COc2cccc(CNc3ccc(Cl)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c21-19-9-6-16(11-20(19)22)23-12-15-2-1-3-18(10-15)27-13-14-4-7-17(8-5-14)24(25)26/h1-11,23H,12-13H2 |
| InChIKey | OVENUAXNKMBKOB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|