C25H29IN2O4S — CID 126212123
methyl 2-[4-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126212123) has the molecular formula C25H29IN2O4S and a molecular weight of 580.49 g/mol. Its IUPAC name is methyl 2-[4-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126212123 |
| Molecular Formula | C25H29IN2O4S |
| Molecular Weight | 580.49 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | methyl 2-[4-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C#N)CC[C@H](C(C)(C)C)C3)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C25H29IN2O4S/c1-6-31-20-10-15(9-19(26)23(20)32-14-22(29)30-5)13-28-24-18(12-27)17-8-7-16(25(2,3)4)11-21(17)33-24/h9-10,13,16H,6-8,11,14H2,1-5H3/t16-/m0/s1 |
| InChIKey | QUVKVFGYYQFMTB-INIZCTEOSA-N |
| XLogP | 6.08 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|