About 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid
5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid (PubChem CID 126212788) has the molecular formula C20H15N3O3S
and a molecular weight of 377.43 g/mol. Its IUPAC name is 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid |
| PubChem CID | 126212788 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid |
| SMILES | Cc1ccc(-n2nc(C(=O)O)c(/C=C/c3cccs3)c(C#N)c2=O)cc1C |
| InChI | InChI=1S/C20H15N3O3S/c1-12-5-6-14(10-13(12)2)23-19(24)17(11-21)16(18(22-23)20(25)26)8-7-15-4-3-9-27-15/h3-10H,1-2H3,(H,25,26)/b8-7+ |
| InChIKey | XEUWNSMJCBDXBI-BQYQJAHWSA-N |
| XLogP | 3.65 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid?
The IUPAC name of 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid (CID 126212788) is 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid.
What is the SMILES notation for 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid?
The canonical SMILES for 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid is Cc1ccc(-n2nc(C(=O)O)c(/C=C/c3cccs3)c(C#N)c2=O)cc1C.
What is the InChIKey of 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid?
The InChIKey is XEUWNSMJCBDXBI-BQYQJAHWSA-N. The full InChI is InChI=1S/C20H15N3O3S/c1-12-5-6-14(10-13(12)2)23-19(24)17(11-21)16(18(22-23)20(25)26)8-7-15-4-3-9-27-15/h3-10H,1-2H3,(H,25,26)/b8-7+.
What are the key properties of 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid?
5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid has a molecular weight of 377.43 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-1-(3,4-dimethylphenyl)-6-oxo-4-[(E)-2-thiophen-2-ylethenyl]pyridazine-3-carboxylic acid is sourced from PubChem (CID 126212788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).